mirror of
				https://github.com/zulip/zulip.git
				synced 2025-11-03 21:43:21 +00:00 
			
		
		
		
	This commit includes a new `stream_post_policy` setting, by replacing the `is_announcement_only` field from the Stream model, which is done by mirroring the structure of the existing `create_stream_policy`. It includes the necessary schema and database migrations to migrate the is_announcement_only boolean field to stream_post_policy, a smallPositiveInteger field similar to many other settings. This change is done to allow organization administrators to restrict new members from creating and posting to a stream. However, this does not affect admins who are new members. With many tweaks by tabbott to documentation under /help, etc. Fixes #13616.
		
			
				
	
	
		
			621 lines
		
	
	
		
			28 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
			
		
		
	
	
			621 lines
		
	
	
		
			28 KiB
		
	
	
	
		
			Python
		
	
	
	
	
	
from typing import Any, Optional, Tuple, List, Set, Iterable, Mapping, Callable, Dict, \
 | 
						|
    Union
 | 
						|
 | 
						|
from django.utils.translation import ugettext as _
 | 
						|
from django.conf import settings
 | 
						|
from django.db import transaction
 | 
						|
from django.http import HttpRequest, HttpResponse
 | 
						|
 | 
						|
from zerver.lib.exceptions import JsonableError, ErrorCode
 | 
						|
from zerver.lib.request import REQ, has_request_variables
 | 
						|
from zerver.decorator import authenticated_json_post_view, \
 | 
						|
    require_realm_admin, to_non_negative_int, require_non_guest_user
 | 
						|
from zerver.lib.actions import bulk_remove_subscriptions, \
 | 
						|
    do_change_subscription_property, internal_prep_private_message, \
 | 
						|
    internal_prep_stream_message, \
 | 
						|
    gather_subscriptions, \
 | 
						|
    bulk_add_subscriptions, do_send_messages, get_subscriber_emails, do_rename_stream, \
 | 
						|
    do_deactivate_stream, do_change_stream_invite_only, do_add_default_stream, \
 | 
						|
    do_change_stream_description, do_get_streams, \
 | 
						|
    do_remove_default_stream, do_change_stream_post_policy, do_delete_messages, \
 | 
						|
    do_create_default_stream_group, do_add_streams_to_default_stream_group, \
 | 
						|
    do_remove_streams_from_default_stream_group, do_remove_default_stream_group, \
 | 
						|
    do_change_default_stream_group_description, do_change_default_stream_group_name
 | 
						|
from zerver.lib.response import json_success, json_error
 | 
						|
from zerver.lib.streams import access_stream_by_id, access_stream_by_name, \
 | 
						|
    check_stream_name, check_stream_name_available, filter_stream_authorization, \
 | 
						|
    list_to_streams, access_stream_for_delete_or_update, access_default_stream_group_by_id
 | 
						|
from zerver.lib.topic import get_topic_history_for_stream, messages_for_topic
 | 
						|
from zerver.lib.validator import check_string, check_int, check_list, check_dict, \
 | 
						|
    check_bool, check_variable_type, check_capped_string, check_color, check_dict_only, \
 | 
						|
    check_int_in
 | 
						|
from zerver.models import UserProfile, Stream, Realm, UserMessage, \
 | 
						|
    get_system_bot, get_active_user
 | 
						|
 | 
						|
from collections import defaultdict
 | 
						|
import ujson
 | 
						|
 | 
						|
class PrincipalError(JsonableError):
 | 
						|
    code = ErrorCode.UNAUTHORIZED_PRINCIPAL
 | 
						|
    data_fields = ['principal']
 | 
						|
    http_status_code = 403
 | 
						|
 | 
						|
    def __init__(self, principal: str) -> None:
 | 
						|
        self.principal = principal  # type: str
 | 
						|
 | 
						|
    @staticmethod
 | 
						|
    def msg_format() -> str:
 | 
						|
        return _("User not authorized to execute queries on behalf of '{principal}'")
 | 
						|
 | 
						|
def principal_to_user_profile(agent: UserProfile, principal: str) -> UserProfile:
 | 
						|
    try:
 | 
						|
        return get_active_user(principal, agent.realm)
 | 
						|
    except UserProfile.DoesNotExist:
 | 
						|
        # We have to make sure we don't leak information about which users
 | 
						|
        # are registered for Zulip in a different realm.  We could do
 | 
						|
        # something a little more clever and check the domain part of the
 | 
						|
        # principal to maybe give a better error message
 | 
						|
        raise PrincipalError(principal)
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
def deactivate_stream_backend(request: HttpRequest,
 | 
						|
                              user_profile: UserProfile,
 | 
						|
                              stream_id: int) -> HttpResponse:
 | 
						|
    stream = access_stream_for_delete_or_update(user_profile, stream_id)
 | 
						|
    do_deactivate_stream(stream)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def add_default_stream(request: HttpRequest,
 | 
						|
                       user_profile: UserProfile,
 | 
						|
                       stream_name: str=REQ()) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
 | 
						|
    do_add_default_stream(stream)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def create_default_stream_group(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                                group_name: str=REQ(), description: str=REQ(),
 | 
						|
                                stream_names: List[str]=REQ(validator=check_list(check_string))) -> None:
 | 
						|
    streams = []
 | 
						|
    for stream_name in stream_names:
 | 
						|
        (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
 | 
						|
        streams.append(stream)
 | 
						|
    do_create_default_stream_group(user_profile.realm, group_name, description, streams)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def update_default_stream_group_info(request: HttpRequest, user_profile: UserProfile, group_id: int,
 | 
						|
                                     new_group_name: Optional[str]=REQ(validator=check_string, default=None),
 | 
						|
                                     new_description: Optional[str]=REQ(validator=check_string,
 | 
						|
                                                                        default=None)) -> None:
 | 
						|
    if not new_group_name and not new_description:
 | 
						|
        return json_error(_('You must pass "new_description" or "new_group_name".'))
 | 
						|
 | 
						|
    group = access_default_stream_group_by_id(user_profile.realm, group_id,)
 | 
						|
    if new_group_name is not None:
 | 
						|
        do_change_default_stream_group_name(user_profile.realm, group, new_group_name)
 | 
						|
    if new_description is not None:
 | 
						|
        do_change_default_stream_group_description(user_profile.realm, group, new_description)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def update_default_stream_group_streams(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                                        group_id: int, op: str=REQ(),
 | 
						|
                                        stream_names: List[str]=REQ(
 | 
						|
                                            validator=check_list(check_string))) -> None:
 | 
						|
    group = access_default_stream_group_by_id(user_profile.realm, group_id,)
 | 
						|
    streams = []
 | 
						|
    for stream_name in stream_names:
 | 
						|
        (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
 | 
						|
        streams.append(stream)
 | 
						|
 | 
						|
    if op == 'add':
 | 
						|
        do_add_streams_to_default_stream_group(user_profile.realm, group, streams)
 | 
						|
    elif op == 'remove':
 | 
						|
        do_remove_streams_from_default_stream_group(user_profile.realm, group, streams)
 | 
						|
    else:
 | 
						|
        return json_error(_('Invalid value for "op". Specify one of "add" or "remove".'))
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def remove_default_stream_group(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                                group_id: int) -> None:
 | 
						|
    group = access_default_stream_group_by_id(user_profile.realm, group_id)
 | 
						|
    do_remove_default_stream_group(user_profile.realm, group)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def remove_default_stream(request: HttpRequest,
 | 
						|
                          user_profile: UserProfile,
 | 
						|
                          stream_name: str=REQ()) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name,
 | 
						|
                                                     allow_realm_admin=True)
 | 
						|
    do_remove_default_stream(stream)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def update_stream_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        stream_id: int,
 | 
						|
        description: Optional[str]=REQ(validator=check_capped_string(
 | 
						|
            Stream.MAX_DESCRIPTION_LENGTH), default=None),
 | 
						|
        is_private: Optional[bool]=REQ(validator=check_bool, default=None),
 | 
						|
        is_announcement_only: Optional[bool]=REQ(validator=check_bool, default=None),
 | 
						|
        stream_post_policy: Optional[int]=REQ(validator=check_int_in(
 | 
						|
            Stream.STREAM_POST_POLICY_TYPES), default=None),
 | 
						|
        history_public_to_subscribers: Optional[bool]=REQ(validator=check_bool, default=None),
 | 
						|
        new_name: Optional[str]=REQ(validator=check_string, default=None),
 | 
						|
) -> HttpResponse:
 | 
						|
    # We allow realm administrators to to update the stream name and
 | 
						|
    # description even for private streams.
 | 
						|
    stream = access_stream_for_delete_or_update(user_profile, stream_id)
 | 
						|
    if description is not None:
 | 
						|
        if '\n' in description:
 | 
						|
            # We don't allow newline characters in stream descriptions.
 | 
						|
            description = description.replace("\n", " ")
 | 
						|
        do_change_stream_description(stream, description)
 | 
						|
    if new_name is not None:
 | 
						|
        new_name = new_name.strip()
 | 
						|
        if stream.name == new_name:
 | 
						|
            return json_error(_("Stream already has that name!"))
 | 
						|
        if stream.name.lower() != new_name.lower():
 | 
						|
            # Check that the stream name is available (unless we are
 | 
						|
            # are only changing the casing of the stream name).
 | 
						|
            check_stream_name_available(user_profile.realm, new_name)
 | 
						|
        do_rename_stream(stream, new_name, user_profile)
 | 
						|
    if is_announcement_only is not None:
 | 
						|
        # is_announcement_only is a legacy way to specify
 | 
						|
        # stream_post_policy.  We can probably just delete this code,
 | 
						|
        # since we're not aware of clients that used it, but we're
 | 
						|
        # keeping it for backwards-compatibility for now.
 | 
						|
        stream_post_policy = Stream.STREAM_POST_POLICY_EVERYONE
 | 
						|
        if is_announcement_only:
 | 
						|
            stream_post_policy = Stream.STREAM_POST_POLICY_ADMINS
 | 
						|
    if stream_post_policy is not None:
 | 
						|
        do_change_stream_post_policy(stream, stream_post_policy)
 | 
						|
 | 
						|
    # But we require even realm administrators to be actually
 | 
						|
    # subscribed to make a private stream public.
 | 
						|
    if is_private is not None:
 | 
						|
        (stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
 | 
						|
        do_change_stream_invite_only(stream, is_private, history_public_to_subscribers)
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def list_subscriptions_backend(
 | 
						|
    request: HttpRequest,
 | 
						|
    user_profile: UserProfile,
 | 
						|
    include_subscribers: bool=REQ(validator=check_bool, default=False),
 | 
						|
) -> HttpResponse:
 | 
						|
    subscribed, _ = gather_subscriptions(
 | 
						|
        user_profile, include_subscribers=include_subscribers
 | 
						|
    )
 | 
						|
    return json_success({"subscriptions": subscribed})
 | 
						|
 | 
						|
FuncKwargPair = Tuple[Callable[..., HttpResponse], Dict[str, Union[int, Iterable[Any]]]]
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def update_subscriptions_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        delete: Iterable[str]=REQ(validator=check_list(check_string), default=[]),
 | 
						|
        add: Iterable[Mapping[str, Any]]=REQ(
 | 
						|
            validator=check_list(check_dict([('name', check_string)])), default=[]),
 | 
						|
) -> HttpResponse:
 | 
						|
    if not add and not delete:
 | 
						|
        return json_error(_('Nothing to do. Specify at least one of "add" or "delete".'))
 | 
						|
 | 
						|
    method_kwarg_pairs = [
 | 
						|
        (add_subscriptions_backend, dict(streams_raw=add)),
 | 
						|
        (remove_subscriptions_backend, dict(streams_raw=delete))
 | 
						|
    ]  # type: List[FuncKwargPair]
 | 
						|
    return compose_views(request, user_profile, method_kwarg_pairs)
 | 
						|
 | 
						|
def compose_views(request, user_profile, method_kwarg_pairs):
 | 
						|
    # type: (HttpRequest, UserProfile, List[FuncKwargPair]) -> HttpResponse
 | 
						|
    '''
 | 
						|
    This takes a series of view methods from method_kwarg_pairs and calls
 | 
						|
    them in sequence, and it smushes all the json results into a single
 | 
						|
    response when everything goes right.  (This helps clients avoid extra
 | 
						|
    latency hops.)  It rolls back the transaction when things go wrong in
 | 
						|
    any one of the composed methods.
 | 
						|
 | 
						|
    TODO: Move this a utils-like module if we end up using it more widely.
 | 
						|
    '''
 | 
						|
 | 
						|
    json_dict = {}  # type: Dict[str, Any]
 | 
						|
    with transaction.atomic():
 | 
						|
        for method, kwargs in method_kwarg_pairs:
 | 
						|
            response = method(request, user_profile, **kwargs)
 | 
						|
            if response.status_code != 200:
 | 
						|
                raise JsonableError(response.content)
 | 
						|
            json_dict.update(ujson.loads(response.content))
 | 
						|
    return json_success(json_dict)
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def remove_subscriptions_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        streams_raw: Iterable[str]=REQ("subscriptions", validator=check_list(check_string)),
 | 
						|
        principals: Optional[Iterable[str]]=REQ(validator=check_list(check_string), default=None),
 | 
						|
) -> HttpResponse:
 | 
						|
 | 
						|
    removing_someone_else = principals and \
 | 
						|
        set(principals) != set((user_profile.email,))
 | 
						|
 | 
						|
    if removing_someone_else and not user_profile.is_realm_admin:
 | 
						|
        # You can only unsubscribe other people from a stream if you are a realm
 | 
						|
        # admin (whether the stream is public or private).
 | 
						|
        return json_error(_("This action requires administrative rights"))
 | 
						|
 | 
						|
    streams_as_dict = []
 | 
						|
    for stream_name in streams_raw:
 | 
						|
        streams_as_dict.append({"name": stream_name.strip()})
 | 
						|
 | 
						|
    streams, __ = list_to_streams(streams_as_dict, user_profile)
 | 
						|
 | 
						|
    if principals:
 | 
						|
        people_to_unsub = set(principal_to_user_profile(
 | 
						|
            user_profile, principal) for principal in principals)
 | 
						|
    else:
 | 
						|
        people_to_unsub = set([user_profile])
 | 
						|
 | 
						|
    result = dict(removed=[], not_removed=[])  # type: Dict[str, List[str]]
 | 
						|
    (removed, not_subscribed) = bulk_remove_subscriptions(people_to_unsub, streams,
 | 
						|
                                                          request.client,
 | 
						|
                                                          acting_user=user_profile)
 | 
						|
 | 
						|
    for (subscriber, removed_stream) in removed:
 | 
						|
        result["removed"].append(removed_stream.name)
 | 
						|
    for (subscriber, not_subscribed_stream) in not_subscribed:
 | 
						|
        result["not_removed"].append(not_subscribed_stream.name)
 | 
						|
 | 
						|
    return json_success(result)
 | 
						|
 | 
						|
def you_were_just_subscribed_message(acting_user: UserProfile,
 | 
						|
                                     stream_names: Set[str]) -> str:
 | 
						|
    subscriptions = sorted(list(stream_names))
 | 
						|
    if len(subscriptions) == 1:
 | 
						|
        return _("@**%(full_name)s** subscribed you to the stream #**%(stream_name)s**.") % \
 | 
						|
            {"full_name": acting_user.full_name,
 | 
						|
             "stream_name": subscriptions[0]}
 | 
						|
 | 
						|
    message = _("@**%(full_name)s** subscribed you to the following streams:") % \
 | 
						|
        {"full_name": acting_user.full_name}
 | 
						|
    message += "\n\n"
 | 
						|
    for stream_name in subscriptions:
 | 
						|
        message += "* #**%s**\n" % (stream_name,)
 | 
						|
    return message
 | 
						|
 | 
						|
@require_non_guest_user
 | 
						|
@has_request_variables
 | 
						|
def add_subscriptions_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        streams_raw: Iterable[Dict[str, str]]=REQ(
 | 
						|
            "subscriptions", validator=check_list(check_dict_only(
 | 
						|
                [('name', check_string)], optional_keys=[
 | 
						|
                    ('color', check_color),
 | 
						|
                    ('description', check_capped_string(Stream.MAX_DESCRIPTION_LENGTH)),
 | 
						|
                ])
 | 
						|
            )),
 | 
						|
        invite_only: bool=REQ(validator=check_bool, default=False),
 | 
						|
        stream_post_policy: int=REQ(validator=check_int_in(
 | 
						|
            Stream.STREAM_POST_POLICY_TYPES), default=Stream.STREAM_POST_POLICY_EVERYONE),
 | 
						|
        history_public_to_subscribers: Optional[bool]=REQ(validator=check_bool, default=None),
 | 
						|
        announce: bool=REQ(validator=check_bool, default=False),
 | 
						|
        principals: List[str]=REQ(validator=check_list(check_string), default=[]),
 | 
						|
        authorization_errors_fatal: bool=REQ(validator=check_bool, default=True),
 | 
						|
) -> HttpResponse:
 | 
						|
    stream_dicts = []
 | 
						|
    color_map = {}
 | 
						|
    for stream_dict in streams_raw:
 | 
						|
        # 'color' field is optional
 | 
						|
        # check for its presence in the streams_raw first
 | 
						|
        if 'color' in stream_dict:
 | 
						|
            color_map[stream_dict['name']] = stream_dict['color']
 | 
						|
        if 'description' in stream_dict:
 | 
						|
            # We don't allow newline characters in stream descriptions.
 | 
						|
            stream_dict['description'] = stream_dict['description'].replace("\n", " ")
 | 
						|
 | 
						|
        stream_dict_copy = {}  # type: Dict[str, Any]
 | 
						|
        for field in stream_dict:
 | 
						|
            stream_dict_copy[field] = stream_dict[field]
 | 
						|
        # Strip the stream name here.
 | 
						|
        stream_dict_copy['name'] = stream_dict_copy['name'].strip()
 | 
						|
        stream_dict_copy["invite_only"] = invite_only
 | 
						|
        stream_dict_copy["stream_post_policy"] = stream_post_policy
 | 
						|
        stream_dict_copy["history_public_to_subscribers"] = history_public_to_subscribers
 | 
						|
        stream_dicts.append(stream_dict_copy)
 | 
						|
 | 
						|
    # Validation of the streams arguments, including enforcement of
 | 
						|
    # can_create_streams policy and check_stream_name policy is inside
 | 
						|
    # list_to_streams.
 | 
						|
    existing_streams, created_streams = \
 | 
						|
        list_to_streams(stream_dicts, user_profile, autocreate=True)
 | 
						|
    authorized_streams, unauthorized_streams = \
 | 
						|
        filter_stream_authorization(user_profile, existing_streams)
 | 
						|
    if len(unauthorized_streams) > 0 and authorization_errors_fatal:
 | 
						|
        return json_error(_("Unable to access stream (%s).") % unauthorized_streams[0].name)
 | 
						|
    # Newly created streams are also authorized for the creator
 | 
						|
    streams = authorized_streams + created_streams
 | 
						|
 | 
						|
    if len(principals) > 0:
 | 
						|
        if user_profile.realm.is_zephyr_mirror_realm and not all(stream.invite_only for stream in streams):
 | 
						|
            return json_error(_("You can only invite other Zephyr mirroring users to private streams."))
 | 
						|
        if not user_profile.can_subscribe_other_users():
 | 
						|
            if user_profile.realm.invite_to_stream_policy == Realm.INVITE_TO_STREAM_POLICY_ADMINS:
 | 
						|
                return json_error(_("Only administrators can modify other users' subscriptions."))
 | 
						|
            # Realm.INVITE_TO_STREAM_POLICY_MEMBERS only fails if the
 | 
						|
            # user is a guest, which happens in the decorator above.
 | 
						|
            assert user_profile.realm.invite_to_stream_policy == \
 | 
						|
                Realm.INVITE_TO_STREAM_POLICY_WAITING_PERIOD
 | 
						|
            return json_error(_("Your account is too new to modify other users' subscriptions."))
 | 
						|
        subscribers = set(principal_to_user_profile(user_profile, principal) for principal in principals)
 | 
						|
    else:
 | 
						|
        subscribers = set([user_profile])
 | 
						|
 | 
						|
    (subscribed, already_subscribed) = bulk_add_subscriptions(streams, subscribers,
 | 
						|
                                                              acting_user=user_profile, color_map=color_map)
 | 
						|
 | 
						|
    # We can assume unique emails here for now, but we should eventually
 | 
						|
    # convert this function to be more id-centric.
 | 
						|
    email_to_user_profile = dict()  # type: Dict[str, UserProfile]
 | 
						|
 | 
						|
    result = dict(subscribed=defaultdict(list), already_subscribed=defaultdict(list))  # type: Dict[str, Any]
 | 
						|
    for (subscriber, stream) in subscribed:
 | 
						|
        result["subscribed"][subscriber.email].append(stream.name)
 | 
						|
        email_to_user_profile[subscriber.email] = subscriber
 | 
						|
    for (subscriber, stream) in already_subscribed:
 | 
						|
        result["already_subscribed"][subscriber.email].append(stream.name)
 | 
						|
 | 
						|
    bots = dict((subscriber.email, subscriber.is_bot) for subscriber in subscribers)
 | 
						|
 | 
						|
    newly_created_stream_names = {s.name for s in created_streams}
 | 
						|
 | 
						|
    # Inform the user if someone else subscribed them to stuff,
 | 
						|
    # or if a new stream was created with the "announce" option.
 | 
						|
    notifications = []
 | 
						|
    if len(principals) > 0 and result["subscribed"]:
 | 
						|
        for email, subscribed_stream_names in result["subscribed"].items():
 | 
						|
            if email == user_profile.email:
 | 
						|
                # Don't send a Zulip if you invited yourself.
 | 
						|
                continue
 | 
						|
            if bots[email]:
 | 
						|
                # Don't send invitation Zulips to bots
 | 
						|
                continue
 | 
						|
 | 
						|
            # For each user, we notify them about newly subscribed streams, except for
 | 
						|
            # streams that were newly created.
 | 
						|
            notify_stream_names = set(subscribed_stream_names) - newly_created_stream_names
 | 
						|
 | 
						|
            if not notify_stream_names:
 | 
						|
                continue
 | 
						|
 | 
						|
            msg = you_were_just_subscribed_message(
 | 
						|
                acting_user=user_profile,
 | 
						|
                stream_names=notify_stream_names,
 | 
						|
            )
 | 
						|
 | 
						|
            sender = get_system_bot(settings.NOTIFICATION_BOT)
 | 
						|
            notifications.append(
 | 
						|
                internal_prep_private_message(
 | 
						|
                    realm=user_profile.realm,
 | 
						|
                    sender=sender,
 | 
						|
                    recipient_user=email_to_user_profile[email],
 | 
						|
                    content=msg))
 | 
						|
 | 
						|
    if announce and len(created_streams) > 0:
 | 
						|
        notifications_stream = user_profile.realm.get_notifications_stream()
 | 
						|
        if notifications_stream is not None:
 | 
						|
            if len(created_streams) > 1:
 | 
						|
                content = _("@_**%(user_name)s|%(user_id)d** created the following streams: %(stream_str)s.")
 | 
						|
            else:
 | 
						|
                content = _("@_**%(user_name)s|%(user_id)d** created a new stream %(stream_str)s.")
 | 
						|
            content = content % {
 | 
						|
                'user_name': user_profile.full_name,
 | 
						|
                'user_id': user_profile.id,
 | 
						|
                'stream_str': ", ".join('#**%s**' % (s.name,) for s in created_streams)}
 | 
						|
 | 
						|
            sender = get_system_bot(settings.NOTIFICATION_BOT)
 | 
						|
            topic = _('new streams')
 | 
						|
 | 
						|
            notifications.append(
 | 
						|
                internal_prep_stream_message(
 | 
						|
                    realm=user_profile.realm,
 | 
						|
                    sender=sender,
 | 
						|
                    stream=notifications_stream,
 | 
						|
                    topic=topic,
 | 
						|
                    content=content,
 | 
						|
                )
 | 
						|
            )
 | 
						|
 | 
						|
    if not user_profile.realm.is_zephyr_mirror_realm and len(created_streams) > 0:
 | 
						|
        sender = get_system_bot(settings.NOTIFICATION_BOT)
 | 
						|
        for stream in created_streams:
 | 
						|
            notifications.append(
 | 
						|
                internal_prep_stream_message(
 | 
						|
                    realm=user_profile.realm,
 | 
						|
                    sender=sender,
 | 
						|
                    stream=stream,
 | 
						|
                    topic=Realm.STREAM_EVENTS_NOTIFICATION_TOPIC,
 | 
						|
                    content=_('Stream created by @_**%(user_name)s|%(user_id)d**.') % {
 | 
						|
                        'user_name': user_profile.full_name,
 | 
						|
                        'user_id': user_profile.id}
 | 
						|
                )
 | 
						|
            )
 | 
						|
 | 
						|
    if len(notifications) > 0:
 | 
						|
        do_send_messages(notifications, mark_as_read=[user_profile.id])
 | 
						|
 | 
						|
    result["subscribed"] = dict(result["subscribed"])
 | 
						|
    result["already_subscribed"] = dict(result["already_subscribed"])
 | 
						|
    if not authorization_errors_fatal:
 | 
						|
        result["unauthorized"] = [s.name for s in unauthorized_streams]
 | 
						|
    return json_success(result)
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def get_subscribers_backend(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                            stream_id: int=REQ('stream', converter=to_non_negative_int)) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_id(user_profile, stream_id,
 | 
						|
                                                   allow_realm_admin=True)
 | 
						|
    subscribers = get_subscriber_emails(stream, user_profile)
 | 
						|
 | 
						|
    return json_success({'subscribers': subscribers})
 | 
						|
 | 
						|
# By default, lists all streams that the user has access to --
 | 
						|
# i.e. public streams plus invite-only streams that the user is on
 | 
						|
@has_request_variables
 | 
						|
def get_streams_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        include_public: bool=REQ(validator=check_bool, default=True),
 | 
						|
        include_subscribed: bool=REQ(validator=check_bool, default=True),
 | 
						|
        include_all_active: bool=REQ(validator=check_bool, default=False),
 | 
						|
        include_default: bool=REQ(validator=check_bool, default=False),
 | 
						|
        include_owner_subscribed: bool=REQ(validator=check_bool, default=False)
 | 
						|
) -> HttpResponse:
 | 
						|
 | 
						|
    streams = do_get_streams(user_profile, include_public=include_public,
 | 
						|
                             include_subscribed=include_subscribed,
 | 
						|
                             include_all_active=include_all_active,
 | 
						|
                             include_default=include_default,
 | 
						|
                             include_owner_subscribed=include_owner_subscribed)
 | 
						|
    return json_success({"streams": streams})
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def get_topics_backend(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                       stream_id: int=REQ(converter=to_non_negative_int,
 | 
						|
                                          path_only=True)) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
 | 
						|
 | 
						|
    result = get_topic_history_for_stream(
 | 
						|
        user_profile=user_profile,
 | 
						|
        recipient=recipient,
 | 
						|
        public_history=stream.is_history_public_to_subscribers(),
 | 
						|
    )
 | 
						|
 | 
						|
    return json_success(dict(topics=result))
 | 
						|
 | 
						|
@require_realm_admin
 | 
						|
@has_request_variables
 | 
						|
def delete_in_topic(request: HttpRequest, user_profile: UserProfile,
 | 
						|
                    stream_id: int=REQ(converter=to_non_negative_int),
 | 
						|
                    topic_name: str=REQ("topic_name")) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
 | 
						|
 | 
						|
    messages = messages_for_topic(stream.id, topic_name)
 | 
						|
    if not stream.is_history_public_to_subscribers():
 | 
						|
        # Don't allow the user to delete messages that they don't have access to.
 | 
						|
        deletable_message_ids = UserMessage.objects.filter(
 | 
						|
            user_profile=user_profile, message_id__in=messages).values_list("message_id", flat=True)
 | 
						|
        messages = [message for message in messages if message.id in
 | 
						|
                    deletable_message_ids]
 | 
						|
 | 
						|
    do_delete_messages(user_profile.realm, messages)
 | 
						|
 | 
						|
    return json_success()
 | 
						|
 | 
						|
@authenticated_json_post_view
 | 
						|
@has_request_variables
 | 
						|
def json_stream_exists(request: HttpRequest, user_profile: UserProfile, stream_name: str=REQ("stream"),
 | 
						|
                       autosubscribe: bool=REQ(validator=check_bool, default=False)) -> HttpResponse:
 | 
						|
    check_stream_name(stream_name)
 | 
						|
 | 
						|
    try:
 | 
						|
        (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
 | 
						|
    except JsonableError as e:
 | 
						|
        return json_error(e.msg, status=404)
 | 
						|
 | 
						|
    # access_stream functions return a subscription if and only if we
 | 
						|
    # are already subscribed.
 | 
						|
    result = {"subscribed": sub is not None}
 | 
						|
 | 
						|
    # If we got here, we're either subscribed or the stream is public.
 | 
						|
    # So if we're not yet subscribed and autosubscribe is enabled, we
 | 
						|
    # should join.
 | 
						|
    if sub is None and autosubscribe:
 | 
						|
        bulk_add_subscriptions([stream], [user_profile], acting_user=user_profile)
 | 
						|
        result["subscribed"] = True
 | 
						|
 | 
						|
    return json_success(result)  # results are ignored for HEAD requests
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def json_get_stream_id(request: HttpRequest,
 | 
						|
                       user_profile: UserProfile,
 | 
						|
                       stream_name: str=REQ('stream')) -> HttpResponse:
 | 
						|
    (stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
 | 
						|
    return json_success({'stream_id': stream.id})
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def update_subscriptions_property(request: HttpRequest,
 | 
						|
                                  user_profile: UserProfile,
 | 
						|
                                  stream_id: int=REQ(validator=check_int),
 | 
						|
                                  property: str=REQ(),
 | 
						|
                                  value: str=REQ()) -> HttpResponse:
 | 
						|
    subscription_data = [{"property": property,
 | 
						|
                          "stream_id": stream_id,
 | 
						|
                          "value": value}]
 | 
						|
    return update_subscription_properties_backend(request, user_profile,
 | 
						|
                                                  subscription_data=subscription_data)
 | 
						|
 | 
						|
@has_request_variables
 | 
						|
def update_subscription_properties_backend(
 | 
						|
        request: HttpRequest, user_profile: UserProfile,
 | 
						|
        subscription_data: List[Dict[str, Any]]=REQ(
 | 
						|
            validator=check_list(
 | 
						|
                check_dict([("stream_id", check_int),
 | 
						|
                            ("property", check_string),
 | 
						|
                            ("value", check_variable_type([check_string, check_bool]))])
 | 
						|
            )
 | 
						|
        ),
 | 
						|
) -> HttpResponse:
 | 
						|
    """
 | 
						|
    This is the entry point to changing subscription properties. This
 | 
						|
    is a bulk endpoint: requestors always provide a subscription_data
 | 
						|
    list containing dictionaries for each stream of interest.
 | 
						|
 | 
						|
    Requests are of the form:
 | 
						|
 | 
						|
    [{"stream_id": "1", "property": "is_muted", "value": False},
 | 
						|
     {"stream_id": "1", "property": "color", "value": "#c2c2c2"}]
 | 
						|
    """
 | 
						|
    property_converters = {"color": check_color, "in_home_view": check_bool,
 | 
						|
                           "is_muted": check_bool,
 | 
						|
                           "desktop_notifications": check_bool,
 | 
						|
                           "audible_notifications": check_bool,
 | 
						|
                           "push_notifications": check_bool,
 | 
						|
                           "email_notifications": check_bool,
 | 
						|
                           "pin_to_top": check_bool,
 | 
						|
                           "wildcard_mentions_notify": check_bool}
 | 
						|
    response_data = []
 | 
						|
 | 
						|
    for change in subscription_data:
 | 
						|
        stream_id = change["stream_id"]
 | 
						|
        property = change["property"]
 | 
						|
        value = change["value"]
 | 
						|
 | 
						|
        if property not in property_converters:
 | 
						|
            return json_error(_("Unknown subscription property: %s") % (property,))
 | 
						|
 | 
						|
        (stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
 | 
						|
        if sub is None:
 | 
						|
            return json_error(_("Not subscribed to stream id %d") % (stream_id,))
 | 
						|
 | 
						|
        property_conversion = property_converters[property](property, value)
 | 
						|
        if property_conversion:
 | 
						|
            return json_error(property_conversion)
 | 
						|
 | 
						|
        do_change_subscription_property(user_profile, sub, stream,
 | 
						|
                                        property, value)
 | 
						|
 | 
						|
        response_data.append({'stream_id': stream_id,
 | 
						|
                              'property': property,
 | 
						|
                              'value': value})
 | 
						|
 | 
						|
    return json_success({"subscription_data": response_data})
 |