mirror of
https://github.com/zulip/zulip.git
synced 2025-11-23 16:01:24 +00:00
A bug in Zulip's implementation of the "stream exists" endpoint meant that any user of a Zulip server could subscribe to an invite-only stream without needing to be invited by using the "autosubscribe" argument. Thanks to Rafid Aslam for discovering this issue.
574 lines
26 KiB
Python
574 lines
26 KiB
Python
from __future__ import absolute_import
|
|
from typing import Any, Optional, Tuple, List, Set, Iterable, Mapping, Callable, Dict
|
|
|
|
from django.utils.translation import ugettext as _
|
|
from django.conf import settings
|
|
from django.db import transaction
|
|
from django.http import HttpRequest, HttpResponse
|
|
|
|
from zerver.lib.request import JsonableError, REQ, has_request_variables
|
|
from zerver.decorator import authenticated_json_post_view, \
|
|
authenticated_json_view, \
|
|
get_user_profile_by_email, require_realm_admin, to_non_negative_int
|
|
from zerver.lib.actions import bulk_remove_subscriptions, \
|
|
do_change_subscription_property, internal_prep_message, \
|
|
create_streams_if_needed, gather_subscriptions, subscribed_to_stream, \
|
|
bulk_add_subscriptions, do_send_messages, get_subscriber_emails, do_rename_stream, \
|
|
do_deactivate_stream, do_make_stream_public, do_add_default_stream, \
|
|
do_change_stream_description, do_get_streams, do_make_stream_private, \
|
|
do_remove_default_stream, get_topic_history_for_stream
|
|
from zerver.lib.response import json_success, json_error, json_response
|
|
from zerver.lib.validator import check_string, check_list, check_dict, \
|
|
check_bool, check_variable_type
|
|
from zerver.models import UserProfile, Stream, Realm, Subscription, \
|
|
Recipient, get_recipient, get_stream, bulk_get_streams, \
|
|
bulk_get_recipients, valid_stream_name, get_active_user_dicts_in_realm
|
|
|
|
from collections import defaultdict
|
|
import ujson
|
|
from six.moves import urllib
|
|
|
|
import six
|
|
from typing import Text
|
|
|
|
def is_active_subscriber(user_profile, recipient):
|
|
# type: (UserProfile, Recipient) -> bool
|
|
return Subscription.objects.filter(user_profile=user_profile,
|
|
recipient=recipient,
|
|
active=True).exists()
|
|
|
|
def list_to_streams(streams_raw, user_profile, autocreate=False):
|
|
# type: (Iterable[Mapping[str, Any]], UserProfile, Optional[bool]) -> Tuple[List[Stream], List[Stream]]
|
|
"""Converts list of dicts to a list of Streams, validating input in the process
|
|
|
|
For each stream name, we validate it to ensure it meets our
|
|
requirements for a proper stream name: that is, that it is shorter
|
|
than Stream.MAX_NAME_LENGTH characters and passes
|
|
valid_stream_name.
|
|
|
|
This function in autocreate mode should be atomic: either an exception will be raised
|
|
during a precheck, or all the streams specified will have been created if applicable.
|
|
|
|
@param streams_raw The list of stream dictionaries to process;
|
|
names should already be stripped of whitespace by the caller.
|
|
@param user_profile The user for whom we are retreiving the streams
|
|
@param autocreate Whether we should create streams if they don't already exist
|
|
"""
|
|
# Validate all streams, getting extant ones, then get-or-creating the rest.
|
|
|
|
stream_set = set(stream_dict["name"] for stream_dict in streams_raw)
|
|
|
|
for stream_name in stream_set:
|
|
# Stream names should already have been stripped by the
|
|
# caller, but it makes sense to verify anyway.
|
|
assert stream_name == stream_name.strip()
|
|
if len(stream_name) > Stream.MAX_NAME_LENGTH:
|
|
raise JsonableError(_("Stream name (%s) too long.") % (stream_name,))
|
|
if not valid_stream_name(stream_name):
|
|
raise JsonableError(_("Invalid stream name (%s).") % (stream_name,))
|
|
|
|
existing_streams = [] # type: List[Stream]
|
|
missing_stream_dicts = [] # type: List[Mapping[str, Any]]
|
|
existing_stream_map = bulk_get_streams(user_profile.realm, stream_set)
|
|
|
|
for stream_dict in streams_raw:
|
|
stream_name = stream_dict["name"]
|
|
stream = existing_stream_map.get(stream_name.lower())
|
|
if stream is None:
|
|
missing_stream_dicts.append(stream_dict)
|
|
else:
|
|
existing_streams.append(stream)
|
|
|
|
if len(missing_stream_dicts) == 0:
|
|
# This is the happy path for callers who expected all of these
|
|
# streams to exist already.
|
|
created_streams = [] # type: List[Stream]
|
|
else:
|
|
# autocreate=True path starts here
|
|
if not user_profile.can_create_streams():
|
|
raise JsonableError(_('User cannot create streams.'))
|
|
elif not autocreate:
|
|
raise JsonableError(_("Stream(s) (%s) do not exist") % ", ".join(
|
|
stream_dict["name"] for stream_dict in missing_stream_dicts))
|
|
|
|
# We already filtered out existing streams, so dup_streams
|
|
# will normally be an empty list below, but we protect against somebody
|
|
# else racing to create the same stream. (This is not an entirely
|
|
# paranoid approach, since often on Zulip two people will discuss
|
|
# creating a new stream, and both people eagerly do it.)
|
|
created_streams, dup_streams = create_streams_if_needed(realm=user_profile.realm,
|
|
stream_dicts=missing_stream_dicts)
|
|
existing_streams += dup_streams
|
|
|
|
return existing_streams, created_streams
|
|
|
|
class PrincipalError(JsonableError):
|
|
def __init__(self, principal, status_code=403):
|
|
# type: (Text, int) -> None
|
|
self.principal = principal # type: Text
|
|
self.status_code = status_code # type: int
|
|
|
|
def to_json_error_msg(self):
|
|
# type: () -> Text
|
|
return ("User not authorized to execute queries on behalf of '%s'"
|
|
% (self.principal,))
|
|
|
|
def principal_to_user_profile(agent, principal):
|
|
# type: (UserProfile, Text) -> UserProfile
|
|
principal_doesnt_exist = False
|
|
try:
|
|
principal_user_profile = get_user_profile_by_email(principal)
|
|
except UserProfile.DoesNotExist:
|
|
principal_doesnt_exist = True
|
|
|
|
if (principal_doesnt_exist or
|
|
agent.realm != principal_user_profile.realm):
|
|
# We have to make sure we don't leak information about which users
|
|
# are registered for Zulip in a different realm. We could do
|
|
# something a little more clever and check the domain part of the
|
|
# principal to maybe give a better error message
|
|
raise PrincipalError(principal)
|
|
|
|
return principal_user_profile
|
|
|
|
@require_realm_admin
|
|
def deactivate_stream_backend(request, user_profile, stream_id):
|
|
# type: (HttpRequest, UserProfile, int) -> HttpResponse
|
|
target = get_and_validate_stream_by_id(stream_id, user_profile.realm)
|
|
|
|
if target.invite_only and not subscribed_to_stream(user_profile, target):
|
|
return json_error(_('Cannot administer invite-only streams this way'))
|
|
|
|
do_deactivate_stream(target)
|
|
return json_success()
|
|
|
|
@require_realm_admin
|
|
@has_request_variables
|
|
def add_default_stream(request, user_profile, stream_name=REQ()):
|
|
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
|
|
do_add_default_stream(user_profile.realm, stream_name)
|
|
return json_success()
|
|
|
|
@require_realm_admin
|
|
@has_request_variables
|
|
def remove_default_stream(request, user_profile, stream_name=REQ()):
|
|
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
|
|
do_remove_default_stream(user_profile.realm, stream_name)
|
|
return json_success()
|
|
|
|
@require_realm_admin
|
|
@has_request_variables
|
|
def update_stream_backend(request, user_profile, stream_id,
|
|
description=REQ(validator=check_string, default=None),
|
|
is_private=REQ(validator=check_bool, default=None),
|
|
new_name=REQ(validator=check_string, default=None)):
|
|
# type: (HttpRequest, UserProfile, int, Optional[Text], Optional[bool], Optional[Text]) -> HttpResponse
|
|
stream = get_and_validate_stream_by_id(stream_id, user_profile.realm)
|
|
stream_name = stream.name
|
|
|
|
if description is not None:
|
|
do_change_stream_description(user_profile.realm, stream_name, description)
|
|
if stream_name is not None and new_name is not None:
|
|
do_rename_stream(user_profile.realm, stream_name, new_name)
|
|
if is_private is not None:
|
|
if is_private:
|
|
do_make_stream_private(user_profile.realm, stream_name)
|
|
else:
|
|
do_make_stream_public(user_profile, user_profile.realm, stream_name)
|
|
return json_success()
|
|
|
|
def list_subscriptions_backend(request, user_profile):
|
|
# type: (HttpRequest, UserProfile) -> HttpResponse
|
|
return json_success({"subscriptions": gather_subscriptions(user_profile)[0]})
|
|
|
|
FuncKwargPair = Tuple[Callable[..., HttpResponse], Dict[str, Iterable[Any]]]
|
|
|
|
@has_request_variables
|
|
def update_subscriptions_backend(request, user_profile,
|
|
delete=REQ(validator=check_list(check_string), default=[]),
|
|
add=REQ(validator=check_list(check_dict([('name', check_string)])), default=[])):
|
|
# type: (HttpRequest, UserProfile, Iterable[Text], Iterable[Mapping[str, Any]]) -> HttpResponse
|
|
if not add and not delete:
|
|
return json_error(_('Nothing to do. Specify at least one of "add" or "delete".'))
|
|
|
|
method_kwarg_pairs = [
|
|
(add_subscriptions_backend, dict(streams_raw=add)),
|
|
(remove_subscriptions_backend, dict(streams_raw=delete))
|
|
] # type: List[FuncKwargPair]
|
|
return compose_views(request, user_profile, method_kwarg_pairs)
|
|
|
|
def compose_views(request, user_profile, method_kwarg_pairs):
|
|
# type: (HttpRequest, UserProfile, List[FuncKwargPair]) -> HttpResponse
|
|
'''
|
|
This takes a series of view methods from method_kwarg_pairs and calls
|
|
them in sequence, and it smushes all the json results into a single
|
|
response when everything goes right. (This helps clients avoid extra
|
|
latency hops.) It rolls back the transaction when things go wrong in
|
|
any one of the composed methods.
|
|
|
|
TODO: Move this a utils-like module if we end up using it more widely.
|
|
'''
|
|
|
|
json_dict = {} # type: Dict[str, Any]
|
|
with transaction.atomic():
|
|
for method, kwargs in method_kwarg_pairs:
|
|
response = method(request, user_profile, **kwargs)
|
|
if response.status_code != 200:
|
|
raise JsonableError(response.content)
|
|
json_dict.update(ujson.loads(response.content))
|
|
return json_success(json_dict)
|
|
|
|
@authenticated_json_post_view
|
|
def json_remove_subscriptions(request, user_profile):
|
|
# type: (HttpRequest, UserProfile) -> HttpResponse
|
|
return remove_subscriptions_backend(request, user_profile)
|
|
|
|
@has_request_variables
|
|
def remove_subscriptions_backend(request, user_profile,
|
|
streams_raw = REQ("subscriptions", validator=check_list(check_string)),
|
|
principals = REQ(validator=check_list(check_string), default=None)):
|
|
# type: (HttpRequest, UserProfile, Iterable[Text], Optional[Iterable[Text]]) -> HttpResponse
|
|
|
|
removing_someone_else = principals and \
|
|
set(principals) != set((user_profile.email,))
|
|
if removing_someone_else and not user_profile.is_realm_admin:
|
|
# You can only unsubscribe other people from a stream if you are a realm
|
|
# admin.
|
|
return json_error(_("This action requires administrative rights"))
|
|
|
|
streams_as_dict = []
|
|
for stream_name in streams_raw:
|
|
streams_as_dict.append({"name": stream_name.strip()})
|
|
|
|
streams, __ = list_to_streams(streams_as_dict, user_profile)
|
|
|
|
for stream in streams:
|
|
if removing_someone_else and stream.invite_only and \
|
|
not subscribed_to_stream(user_profile, stream):
|
|
# Even as an admin, you can't remove other people from an
|
|
# invite-only stream you're not on.
|
|
return json_error(_("Cannot administer invite-only streams this way"))
|
|
|
|
if principals:
|
|
people_to_unsub = set(principal_to_user_profile(
|
|
user_profile, principal) for principal in principals)
|
|
else:
|
|
people_to_unsub = set([user_profile])
|
|
|
|
result = dict(removed=[], not_subscribed=[]) # type: Dict[str, List[Text]]
|
|
(removed, not_subscribed) = bulk_remove_subscriptions(people_to_unsub, streams)
|
|
|
|
for (subscriber, stream) in removed:
|
|
result["removed"].append(stream.name)
|
|
for (subscriber, stream) in not_subscribed:
|
|
result["not_subscribed"].append(stream.name)
|
|
|
|
return json_success(result)
|
|
|
|
def filter_stream_authorization(user_profile, streams):
|
|
# type: (UserProfile, Iterable[Stream]) -> Tuple[List[Stream], List[Stream]]
|
|
streams_subscribed = set() # type: Set[int]
|
|
recipients_map = bulk_get_recipients(Recipient.STREAM, [stream.id for stream in streams])
|
|
subs = Subscription.objects.filter(user_profile=user_profile,
|
|
recipient__in=list(recipients_map.values()),
|
|
active=True)
|
|
|
|
for sub in subs:
|
|
streams_subscribed.add(sub.recipient.type_id)
|
|
|
|
unauthorized_streams = [] # type: List[Stream]
|
|
for stream in streams:
|
|
# The user is authorized for his own streams
|
|
if stream.id in streams_subscribed:
|
|
continue
|
|
|
|
# The user is not authorized for invite_only streams
|
|
if stream.invite_only:
|
|
unauthorized_streams.append(stream)
|
|
|
|
authorized_streams = [stream for stream in streams if
|
|
stream.id not in set(stream.id for stream in unauthorized_streams)]
|
|
return authorized_streams, unauthorized_streams
|
|
|
|
@has_request_variables
|
|
def add_subscriptions_backend(request, user_profile,
|
|
streams_raw = REQ("subscriptions",
|
|
validator=check_list(check_dict([('name', check_string)]))),
|
|
invite_only = REQ(validator=check_bool, default=False),
|
|
announce = REQ(validator=check_bool, default=False),
|
|
principals = REQ(validator=check_list(check_string), default=None),
|
|
authorization_errors_fatal = REQ(validator=check_bool, default=True)):
|
|
# type: (HttpRequest, UserProfile, Iterable[Mapping[str, Text]], bool, bool, Optional[List[Text]], bool) -> HttpResponse
|
|
stream_dicts = []
|
|
for stream_dict in streams_raw:
|
|
stream_dict_copy = {} # type: Dict[str, Any]
|
|
for field in stream_dict:
|
|
stream_dict_copy[field] = stream_dict[field]
|
|
# Strip the stream name here.
|
|
stream_dict_copy['name'] = stream_dict_copy['name'].strip()
|
|
stream_dict_copy["invite_only"] = invite_only
|
|
stream_dicts.append(stream_dict_copy)
|
|
|
|
# Validation of the streams arguments, including enforcement of
|
|
# can_create_streams policy and valid_stream_name policy is inside
|
|
# list_to_streams.
|
|
existing_streams, created_streams = \
|
|
list_to_streams(stream_dicts, user_profile, autocreate=True)
|
|
authorized_streams, unauthorized_streams = \
|
|
filter_stream_authorization(user_profile, existing_streams)
|
|
if len(unauthorized_streams) > 0 and authorization_errors_fatal:
|
|
return json_error(_("Unable to access stream (%s).") % unauthorized_streams[0].name)
|
|
# Newly created streams are also authorized for the creator
|
|
streams = authorized_streams + created_streams
|
|
|
|
if principals is not None:
|
|
if user_profile.realm.is_zephyr_mirror_realm and not all(stream.invite_only for stream in streams):
|
|
return json_error(_("You can only invite other Zephyr mirroring users to invite-only streams."))
|
|
subscribers = set(principal_to_user_profile(user_profile, principal) for principal in principals)
|
|
else:
|
|
subscribers = set([user_profile])
|
|
|
|
(subscribed, already_subscribed) = bulk_add_subscriptions(streams, subscribers)
|
|
|
|
result = dict(subscribed=defaultdict(list), already_subscribed=defaultdict(list)) # type: Dict[str, Any]
|
|
for (subscriber, stream) in subscribed:
|
|
result["subscribed"][subscriber.email].append(stream.name)
|
|
for (subscriber, stream) in already_subscribed:
|
|
result["already_subscribed"][subscriber.email].append(stream.name)
|
|
|
|
private_streams = dict((stream.name, stream.invite_only) for stream in streams)
|
|
bots = dict((subscriber.email, subscriber.is_bot) for subscriber in subscribers)
|
|
|
|
# Inform the user if someone else subscribed them to stuff,
|
|
# or if a new stream was created with the "announce" option.
|
|
notifications = []
|
|
if principals and result["subscribed"]:
|
|
for email, subscriptions in six.iteritems(result["subscribed"]):
|
|
if email == user_profile.email:
|
|
# Don't send a Zulip if you invited yourself.
|
|
continue
|
|
if bots[email]:
|
|
# Don't send invitation Zulips to bots
|
|
continue
|
|
|
|
if len(subscriptions) == 1:
|
|
msg = ("Hi there! We thought you'd like to know that %s just "
|
|
"subscribed you to the%s stream #**%s**."
|
|
% (user_profile.full_name,
|
|
" **invite-only**" if private_streams[subscriptions[0]] else "",
|
|
subscriptions[0],
|
|
))
|
|
else:
|
|
msg = ("Hi there! We thought you'd like to know that %s just "
|
|
"subscribed you to the following streams: \n\n"
|
|
% (user_profile.full_name,))
|
|
for stream in subscriptions:
|
|
msg += "* #**%s**%s\n" % (
|
|
stream,
|
|
" (**invite-only**)" if private_streams[stream] else "")
|
|
|
|
if len([s for s in subscriptions if not private_streams[s]]) > 0:
|
|
msg += "\nYou can see historical content on a non-invite-only stream by narrowing to it."
|
|
notifications.append(internal_prep_message(
|
|
user_profile.realm, settings.NOTIFICATION_BOT,
|
|
"private", email, "", msg))
|
|
|
|
if announce and len(created_streams) > 0:
|
|
notifications_stream = user_profile.realm.notifications_stream
|
|
if notifications_stream is not None:
|
|
if len(created_streams) > 1:
|
|
stream_msg = "the following streams: %s" % (", ".join('#**%s**' % s.name for s in created_streams))
|
|
else:
|
|
stream_msg = "a new stream #**%s**." % created_streams[0].name
|
|
msg = ("%s just created %s" % (user_profile.full_name, stream_msg))
|
|
notifications.append(
|
|
internal_prep_message(user_profile.realm, settings.NOTIFICATION_BOT,
|
|
"stream",
|
|
notifications_stream.name, "Streams", msg))
|
|
else:
|
|
msg = ("Hi there! %s just created a new stream #**%s**."
|
|
% (user_profile.full_name, created_streams[0].name))
|
|
for realm_user_dict in get_active_user_dicts_in_realm(user_profile.realm):
|
|
# Don't announce to yourself or to people you explicitly added
|
|
# (who will get the notification above instead).
|
|
if realm_user_dict['email'] in principals or realm_user_dict['email'] == user_profile.email:
|
|
continue
|
|
notifications.append(internal_prep_message(
|
|
user_profile.realm, settings.NOTIFICATION_BOT,
|
|
"private",
|
|
realm_user_dict['email'], "", msg))
|
|
|
|
if len(notifications) > 0:
|
|
do_send_messages(notifications)
|
|
|
|
result["subscribed"] = dict(result["subscribed"])
|
|
result["already_subscribed"] = dict(result["already_subscribed"])
|
|
if not authorization_errors_fatal:
|
|
result["unauthorized"] = [stream.name for stream in unauthorized_streams]
|
|
return json_success(result)
|
|
|
|
@has_request_variables
|
|
def get_subscribers_backend(request, user_profile,
|
|
stream_id=REQ('stream', converter=to_non_negative_int)):
|
|
# type: (HttpRequest, UserProfile, int) -> HttpResponse
|
|
stream = get_and_validate_stream_by_id(stream_id, user_profile.realm)
|
|
subscribers = get_subscriber_emails(stream, user_profile)
|
|
|
|
return json_success({'subscribers': subscribers})
|
|
|
|
# By default, lists all streams that the user has access to --
|
|
# i.e. public streams plus invite-only streams that the user is on
|
|
@has_request_variables
|
|
def get_streams_backend(request, user_profile,
|
|
include_public=REQ(validator=check_bool, default=True),
|
|
include_subscribed=REQ(validator=check_bool, default=True),
|
|
include_all_active=REQ(validator=check_bool, default=False),
|
|
include_default=REQ(validator=check_bool, default=False)):
|
|
# type: (HttpRequest, UserProfile, bool, bool, bool, bool) -> HttpResponse
|
|
|
|
streams = do_get_streams(user_profile, include_public=include_public,
|
|
include_subscribed=include_subscribed,
|
|
include_all_active=include_all_active,
|
|
include_default=include_default)
|
|
return json_success({"streams": streams})
|
|
|
|
@has_request_variables
|
|
def get_topics_backend(request, user_profile,
|
|
stream_id=REQ(converter=to_non_negative_int)):
|
|
# type: (HttpRequest, UserProfile, int) -> HttpResponse
|
|
stream = get_and_validate_stream_by_id(stream_id, user_profile.realm)
|
|
|
|
if stream.realm_id != user_profile.realm_id:
|
|
return json_error(_("Invalid stream id"))
|
|
|
|
recipient = get_recipient(Recipient.STREAM, stream.id)
|
|
|
|
if not stream.is_public():
|
|
if not is_active_subscriber(user_profile=user_profile,
|
|
recipient=recipient):
|
|
return json_error(_("Invalid stream id"))
|
|
|
|
result = get_topic_history_for_stream(
|
|
user_profile=user_profile,
|
|
recipient=recipient,
|
|
)
|
|
|
|
# Our data structure here is a list of tuples of
|
|
# (topic name, unread count), and it's reverse chronological,
|
|
# so the most recent topic is the first element of the list.
|
|
return json_success(dict(topics=result))
|
|
|
|
|
|
@authenticated_json_post_view
|
|
@has_request_variables
|
|
def json_stream_exists(request, user_profile, stream=REQ(),
|
|
autosubscribe=REQ(default=False)):
|
|
# type: (HttpRequest, UserProfile, Text, bool) -> HttpResponse
|
|
if not valid_stream_name(stream):
|
|
return json_error(_("Invalid characters in stream name"))
|
|
try:
|
|
stream_id = Stream.objects.get(realm=user_profile.realm, name=stream).id
|
|
except Stream.DoesNotExist:
|
|
stream_id = None
|
|
return stream_exists_backend(request, user_profile, stream_id, autosubscribe)
|
|
|
|
def stream_exists_backend(request, user_profile, stream_id, autosubscribe):
|
|
# type: (HttpRequest, UserProfile, int, bool) -> HttpResponse
|
|
try:
|
|
stream = get_and_validate_stream_by_id(stream_id, user_profile.realm)
|
|
except JsonableError:
|
|
stream = None
|
|
result = {"exists": bool(stream)}
|
|
if stream is not None:
|
|
recipient = get_recipient(Recipient.STREAM, stream.id)
|
|
if not stream.invite_only and autosubscribe:
|
|
bulk_add_subscriptions([stream], [user_profile])
|
|
result["subscribed"] = is_active_subscriber(
|
|
user_profile=user_profile,
|
|
recipient=recipient)
|
|
|
|
return json_success(result) # results are ignored for HEAD requests
|
|
return json_response(data=result, status=404)
|
|
|
|
def get_and_validate_stream_by_id(stream_id, realm):
|
|
# type: (int, Realm) -> Stream
|
|
try:
|
|
stream = Stream.objects.get(pk=stream_id, realm_id=realm.id)
|
|
except Stream.DoesNotExist:
|
|
raise JsonableError(_("Invalid stream id"))
|
|
return stream
|
|
|
|
@has_request_variables
|
|
def json_get_stream_id(request, user_profile, stream=REQ()):
|
|
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
|
|
try:
|
|
stream_id = Stream.objects.get(realm=user_profile.realm, name=stream).id
|
|
except Stream.DoesNotExist:
|
|
return json_error(_("No such stream name"))
|
|
return json_success({'stream_id': stream_id})
|
|
|
|
def get_subscription_or_die(stream_name, user_profile):
|
|
# type: (Text, UserProfile) -> Subscription
|
|
stream = get_stream(stream_name, user_profile.realm)
|
|
if not stream:
|
|
raise JsonableError(_("Invalid stream %s") % (stream_name,))
|
|
recipient = get_recipient(Recipient.STREAM, stream.id)
|
|
subscription = Subscription.objects.filter(user_profile=user_profile,
|
|
recipient=recipient, active=True)
|
|
|
|
if not subscription.exists():
|
|
raise JsonableError(_("Not subscribed to stream %s") % (stream_name,))
|
|
|
|
return subscription
|
|
|
|
@authenticated_json_view
|
|
@has_request_variables
|
|
def json_subscription_property(request, user_profile, subscription_data=REQ(
|
|
validator=check_list(
|
|
check_dict([("stream", check_string),
|
|
("property", check_string),
|
|
("value", check_variable_type(
|
|
[check_string, check_bool]))])))):
|
|
# type: (HttpRequest, UserProfile, List[Dict[str, Any]]) -> HttpResponse
|
|
"""
|
|
This is the entry point to changing subscription properties. This
|
|
is a bulk endpoint: requestors always provide a subscription_data
|
|
list containing dictionaries for each stream of interest.
|
|
|
|
Requests are of the form:
|
|
|
|
[{"stream": "devel", "property": "in_home_view", "value": False},
|
|
{"stream": "devel", "property": "color", "value": "#c2c2c2"}]
|
|
"""
|
|
if request.method != "POST":
|
|
return json_error(_("Invalid verb"))
|
|
|
|
property_converters = {"color": check_string, "in_home_view": check_bool,
|
|
"desktop_notifications": check_bool,
|
|
"audible_notifications": check_bool,
|
|
"pin_to_top": check_bool}
|
|
response_data = []
|
|
|
|
for change in subscription_data:
|
|
stream_name = change["stream"]
|
|
property = change["property"]
|
|
value = change["value"]
|
|
|
|
if property not in property_converters:
|
|
return json_error(_("Unknown subscription property: %s") % (property,))
|
|
|
|
sub = get_subscription_or_die(stream_name, user_profile)[0]
|
|
|
|
property_conversion = property_converters[property](property, value)
|
|
if property_conversion:
|
|
return json_error(property_conversion)
|
|
|
|
do_change_subscription_property(user_profile, sub, stream_name,
|
|
property, value)
|
|
|
|
response_data.append({'stream': stream_name,
|
|
'property': property,
|
|
'value': value})
|
|
|
|
return json_success({"subscription_data": response_data})
|